C17H15ClF2 — CID 63433876
1-[chloro-(2,4-difluorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63433876) has the molecular formula C17H15ClF2 and a molecular weight of 292.76 g/mol. Its IUPAC name is 1-[chloro-(2,4-difluorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-[chloro-(2,4-difluorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63433876 |
| Molecular Formula | C17H15ClF2 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[chloro-(2,4-difluorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Fc1ccc(C(Cl)C2CCCc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C17H15ClF2/c18-17(15-9-8-12(19)10-16(15)20)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14,17H,3,5,7H2 |
| InChIKey | YAABCNJYFYIFIB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|