C17H16BrClFN — CID 106762496
(4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine (PubChem CID 106762496) has the molecular formula C17H16BrClFN and a molecular weight of 368.68 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 106762496 |
| Molecular Formula | C17H16BrClFN |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methanamine |
| SMILES | NC(c1ccc(Br)c(Cl)c1F)C1CCCc2ccccc21 |
| InChI | InChI=1S/C17H16BrClFN/c18-14-9-8-13(16(20)15(14)19)17(21)12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,8-9,12,17H,3,5,7,21H2 |
| InChIKey | JDFGESCXNYSIDK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|