C16H13BrClFO — CID 106762057
(4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanol (PubChem CID 106762057) has the molecular formula C16H13BrClFO and a molecular weight of 355.63 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanol.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanol |
|---|---|
| PubChem CID | 106762057 |
| Molecular Formula | C16H13BrClFO |
| Molecular Weight | 355.63 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,3-dihydro-1H-inden-2-yl)methanol |
| SMILES | OC(c1ccc(Br)c(Cl)c1F)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H13BrClFO/c17-13-6-5-12(15(19)14(13)18)16(20)11-7-9-3-1-2-4-10(9)8-11/h1-6,11,16,20H,7-8H2 |
| InChIKey | CJRQZBXAVPUCJS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|