C13H15BrClFO2 — CID 114242073
(4-bromo-3-chloro-2-fluorophenyl)-(3-methyloxan-4-yl)methanol (PubChem CID 114242073) has the molecular formula C13H15BrClFO2 and a molecular weight of 337.62 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(3-methyloxan-4-yl)methanol.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(3-methyloxan-4-yl)methanol |
|---|---|
| PubChem CID | 114242073 |
| Molecular Formula | C13H15BrClFO2 |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(3-methyloxan-4-yl)methanol |
| SMILES | CC1COCCC1C(O)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C13H15BrClFO2/c1-7-6-18-5-4-8(7)13(17)9-2-3-10(14)11(15)12(9)16/h2-3,7-8,13,17H,4-6H2,1H3 |
| InChIKey | LMSUMSWLTHJCLD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|