C14H17BrClFO2 — CID 106765094
(4-bromo-3-chloro-2-fluorophenyl)-(2,4,5-trimethyloxolan-3-yl)methanol (PubChem CID 106765094) has the molecular formula C14H17BrClFO2 and a molecular weight of 351.64 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(2,4,5-trimethyloxolan-3-yl)methanol.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,4,5-trimethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 106765094 |
| Molecular Formula | C14H17BrClFO2 |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,4,5-trimethyloxolan-3-yl)methanol |
| SMILES | CC1OC(C)C(C(O)c2ccc(Br)c(Cl)c2F)C1C |
| InChI | InChI=1S/C14H17BrClFO2/c1-6-7(2)19-8(3)11(6)14(18)9-4-5-10(15)12(16)13(9)17/h4-8,11,14,18H,1-3H3 |
| InChIKey | UEAPPBOLSJGRRM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|