C15H19BrF2O2 — CID 106274426
2-(3-bromo-2,6-difluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethanol (PubChem CID 106274426) has the molecular formula C15H19BrF2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 106274426 |
| Molecular Formula | C15H19BrF2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,4,5-trimethyloxolan-3-yl)ethanol |
| SMILES | CC1OC(C)C(C(O)Cc2c(F)ccc(Br)c2F)C1C |
| InChI | InChI=1S/C15H19BrF2O2/c1-7-8(2)20-9(3)14(7)13(19)6-10-12(17)5-4-11(16)15(10)18/h4-5,7-9,13-14,19H,6H2,1-3H3 |
| InChIKey | YXGLCUFPTQZHJR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|