C13H15BrF2O2 — CID 106265571
2-(3-bromo-2,6-difluorophenyl)-1-(5-methyloxolan-2-yl)ethanol (PubChem CID 106265571) has the molecular formula C13H15BrF2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(5-methyloxolan-2-yl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5-methyloxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 106265571 |
| Molecular Formula | C13H15BrF2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5-methyloxolan-2-yl)ethanol |
| SMILES | CC1CCC(C(O)Cc2c(F)ccc(Br)c2F)O1 |
| InChI | InChI=1S/C13H15BrF2O2/c1-7-2-5-12(18-7)11(17)6-8-10(15)4-3-9(14)13(8)16/h3-4,7,11-12,17H,2,5-6H2,1H3 |
| InChIKey | GARKQBDTWZTHBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|