C15H20BrClFNO — CID 106764578
1-(4-bromo-3-chloro-2-fluorophenyl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine (PubChem CID 106764578) has the molecular formula C15H20BrClFNO and a molecular weight of 364.69 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 106764578 |
| Molecular Formula | C15H20BrClFNO |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine |
| SMILES | CNC(c1ccc(Br)c(Cl)c1F)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C15H20BrClFNO/c1-7-8(2)20-9(3)12(7)15(19-4)10-5-6-11(16)13(17)14(10)18/h5-9,12,15,19H,1-4H3 |
| InChIKey | IKPSNCKLFWERLI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|