C14H18BrClFNS2 — CID 106762881
1-(4-bromo-3-chloro-2-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)-N-methylmethanamine (PubChem CID 106762881) has the molecular formula C14H18BrClFNS2 and a molecular weight of 398.79 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106762881 |
| Molecular Formula | C14H18BrClFNS2 |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)-N-methylmethanamine |
| SMILES | CCC1SCCSC1C(NC)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C14H18BrClFNS2/c1-3-10-14(20-7-6-19-10)13(18-2)8-4-5-9(15)11(16)12(8)17/h4-5,10,13-14,18H,3,6-7H2,1-2H3 |
| InChIKey | ZWUWMOQSPBJVLC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|