C13H16F3NS2 — CID 115386909
N-methyl-1-(3-methyl-1,4-dithian-2-yl)-1-(2,3,4-trifluorophenyl)methanamine (PubChem CID 115386909) has the molecular formula C13H16F3NS2 and a molecular weight of 307.41 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-1,4-dithian-2-yl)-1-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | N-methyl-1-(3-methyl-1,4-dithian-2-yl)-1-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 115386909 |
| Molecular Formula | C13H16F3NS2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-methyl-1-(3-methyl-1,4-dithian-2-yl)-1-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CNC(c1ccc(F)c(F)c1F)C1SCCSC1C |
| InChI | InChI=1S/C13H16F3NS2/c1-7-13(19-6-5-18-7)12(17-2)8-3-4-9(14)11(16)10(8)15/h3-4,7,12-13,17H,5-6H2,1-2H3 |
| InChIKey | WNJKVNBLAFTQCC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|