C13H15BrClFO2 — CID 106762196
1-[(4-bromo-3-chloro-2-fluorophenyl)-hydroxymethyl]cyclohexan-1-ol (PubChem CID 106762196) has the molecular formula C13H15BrClFO2 and a molecular weight of 337.62 g/mol. Its IUPAC name is 1-[(4-bromo-3-chloro-2-fluorophenyl)-hydroxymethyl]cyclohexan-1-ol.
| Compound Name | 1-[(4-bromo-3-chloro-2-fluorophenyl)-hydroxymethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106762196 |
| Molecular Formula | C13H15BrClFO2 |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-[(4-bromo-3-chloro-2-fluorophenyl)-hydroxymethyl]cyclohexan-1-ol |
| SMILES | OC(c1ccc(Br)c(Cl)c1F)C1(O)CCCCC1 |
| InChI | InChI=1S/C13H15BrClFO2/c14-9-5-4-8(11(16)10(9)15)12(17)13(18)6-2-1-3-7-13/h4-5,12,17-18H,1-3,6-7H2 |
| InChIKey | YBAPACUAQUEQBE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|