C16H21BrClFN2 — CID 106762721
(4-bromo-3-chloro-2-fluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanamine (PubChem CID 106762721) has the molecular formula C16H21BrClFN2 and a molecular weight of 375.71 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanamine.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 106762721 |
| Molecular Formula | C16H21BrClFN2 |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(1-pyrrolidin-1-ylcyclopentyl)methanamine |
| SMILES | NC(c1ccc(Br)c(Cl)c1F)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C16H21BrClFN2/c17-12-6-5-11(14(19)13(12)18)15(20)16(7-1-2-8-16)21-9-3-4-10-21/h5-6,15H,1-4,7-10,20H2 |
| InChIKey | ZFQYYPUESPMAMS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|