C14H16BrClFN — CID 106764465
7-bicyclo[4.1.0]heptanyl-(4-bromo-3-chloro-2-fluorophenyl)methanamine (PubChem CID 106764465) has the molecular formula C14H16BrClFN and a molecular weight of 332.64 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-(4-bromo-3-chloro-2-fluorophenyl)methanamine.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-(4-bromo-3-chloro-2-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 106764465 |
| Molecular Formula | C14H16BrClFN |
| Molecular Weight | 332.64 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-(4-bromo-3-chloro-2-fluorophenyl)methanamine |
| SMILES | NC(c1ccc(Br)c(Cl)c1F)C1C2CCCCC21 |
| InChI | InChI=1S/C14H16BrClFN/c15-10-6-5-9(13(17)12(10)16)14(18)11-7-3-1-2-4-8(7)11/h5-8,11,14H,1-4,18H2 |
| InChIKey | MJQQXBXTCDMUAP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|