C14H18BrClFNS — CID 106762589
1-(4-bromo-3-chloro-2-fluorophenyl)-2-cyclohexylsulfanylethanamine (PubChem CID 106762589) has the molecular formula C14H18BrClFNS and a molecular weight of 366.73 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-cyclohexylsulfanylethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-cyclohexylsulfanylethanamine |
|---|---|
| PubChem CID | 106762589 |
| Molecular Formula | C14H18BrClFNS |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-cyclohexylsulfanylethanamine |
| SMILES | NC(CSC1CCCCC1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C14H18BrClFNS/c15-11-7-6-10(14(17)13(11)16)12(18)8-19-9-4-2-1-3-5-9/h6-7,9,12H,1-5,8,18H2 |
| InChIKey | KUFSIOSXCFOOIV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|