C15H20BrClFN — CID 107191802
(4-bromo-3-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanamine (PubChem CID 107191802) has the molecular formula C15H20BrClFN and a molecular weight of 348.69 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanamine.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 107191802 |
| Molecular Formula | C15H20BrClFN |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanamine |
| SMILES | CC1(C)CCCCC1C(N)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C15H20BrClFN/c1-15(2)8-4-3-5-10(15)14(19)9-6-7-11(16)12(17)13(9)18/h6-7,10,14H,3-5,8,19H2,1-2H3 |
| InChIKey | KGQBSDYYBXVTCA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|