C16H22BrClFNO — CID 106763038
(4-bromo-3-chloro-2-fluorophenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methanamine (PubChem CID 106763038) has the molecular formula C16H22BrClFNO and a molecular weight of 378.71 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methanamine.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 106763038 |
| Molecular Formula | C16H22BrClFNO |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(1-methoxy-4,4-dimethylcyclohexyl)methanamine |
| SMILES | COC1(C(N)c2ccc(Br)c(Cl)c2F)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H22BrClFNO/c1-15(2)6-8-16(21-3,9-7-15)14(20)10-4-5-11(17)12(18)13(10)19/h4-5,14H,6-9,20H2,1-3H3 |
| InChIKey | WLZPYDCHRHGCJO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|