C13H17BrClFN2O — CID 106765549
[1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1-methoxycyclobutyl)ethyl]hydrazine (PubChem CID 106765549) has the molecular formula C13H17BrClFN2O and a molecular weight of 351.65 g/mol. Its IUPAC name is [1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1-methoxycyclobutyl)ethyl]hydrazine.
| Compound Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1-methoxycyclobutyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106765549 |
| Molecular Formula | C13H17BrClFN2O |
| Molecular Weight | 351.65 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [1-(4-bromo-3-chloro-2-fluorophenyl)-2-(1-methoxycyclobutyl)ethyl]hydrazine |
| SMILES | COC1(CC(NN)c2ccc(Br)c(Cl)c2F)CCC1 |
| InChI | InChI=1S/C13H17BrClFN2O/c1-19-13(5-2-6-13)7-10(18-17)8-3-4-9(14)11(15)12(8)16/h3-4,10,18H,2,5-7,17H2,1H3 |
| InChIKey | ONGDAXXRZJNTQQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|