C15H21BrClFN2 — CID 106762696
1-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethyl-2-pyrrolidin-1-ylpropan-1-amine (PubChem CID 106762696) has the molecular formula C15H21BrClFN2 and a molecular weight of 363.70 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethyl-2-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethyl-2-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 106762696 |
| Molecular Formula | C15H21BrClFN2 |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethyl-2-pyrrolidin-1-ylpropan-1-amine |
| SMILES | CNC(c1ccc(Br)c(Cl)c1F)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C15H21BrClFN2/c1-15(2,20-8-4-5-9-20)14(19-3)10-6-7-11(16)12(17)13(10)18/h6-7,14,19H,4-5,8-9H2,1-3H3 |
| InChIKey | JIYXRLMTCNEOQW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|