C17H30 — CID 144539733
ethane;1-propan-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 144539733) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is ethane;1-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethane;1-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 144539733 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | ethane;1-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC.CC.CC(C)C1CCCc2ccccc21 |
| InChI | InChI=1S/C13H18.2C2H6/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;2*1-2/h3-4,6,8,10,12H,5,7,9H2,1-2H3;2*1-2H3 |
| InChIKey | BOGBPEMSWPKCCC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |