About 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene
6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 59559014) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
Analyze 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene (CID 59559014) is 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene is Cc1ccc2c(c1)CCCC2C(C)C.
What is the InChIKey of 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is VZTJYAIWQSCMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-10(2)13-6-4-5-12-9-11(3)7-8-14(12)13/h7-10,13H,4-6H2,1-3H3.
What are the key properties of 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 188.31 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-propan-2-yl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 59559014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).