C14H21N — CID 115705716
N-butan-2-yl-5-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 115705716) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-butan-2-yl-5-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-butan-2-yl-5-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 115705716 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-butan-2-yl-5-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCC(C)NC1CCc2cc(C)ccc21 |
| InChI | InChI=1S/C14H21N/c1-4-11(3)15-14-8-6-12-9-10(2)5-7-13(12)14/h5,7,9,11,14-15H,4,6,8H2,1-3H3 |
| InChIKey | GYEFZANPHWBMEZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |