C15H22FNS — CID 115725424
N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 115725424) has the molecular formula C15H22FNS and a molecular weight of 267.41 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 115725424 |
| Molecular Formula | C15H22FNS |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCSCCC(C)NC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H22FNS/c1-3-18-9-8-11(2)17-15-7-4-12-10-13(16)5-6-14(12)15/h5-6,10-11,15,17H,3-4,7-9H2,1-2H3 |
| InChIKey | FNUNUEBPWZGWNT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|