C16H22 — CID 170538993
(6Z)-11-propan-2-yl-8,9,10,11-tetrahydro-5H-benzo[9]annulene (PubChem CID 170538993) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (6Z)-11-propan-2-yl-8,9,10,11-tetrahydro-5H-benzo[9]annulene.
| Compound Name | (6Z)-11-propan-2-yl-8,9,10,11-tetrahydro-5H-benzo[9]annulene |
|---|---|
| PubChem CID | 170538993 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (6Z)-11-propan-2-yl-8,9,10,11-tetrahydro-5H-benzo[9]annulene |
| SMILES | CC(C)C1CCC/C=C\Cc2ccccc21 |
| InChI | InChI=1S/C16H22/c1-13(2)15-11-6-4-3-5-9-14-10-7-8-12-16(14)15/h3,5,7-8,10,12-13,15H,4,6,9,11H2,1-2H3/b5-3- |
| InChIKey | KLFBHCPNOFHMKP-HYXAFXHYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|