C12H16 — CID 155790145
1-propan-2-yl-4-tritio-2,3-dihydro-1H-indene (PubChem CID 155790145) has the molecular formula C12H16 and a molecular weight of 162.27 g/mol. Its IUPAC name is 1-propan-2-yl-4-tritio-2,3-dihydro-1H-indene.
| Compound Name | 1-propan-2-yl-4-tritio-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 155790145 |
| Molecular Formula | C12H16 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 1-propan-2-yl-4-tritio-2,3-dihydro-1H-indene |
| SMILES | [3H]c1cccc2c1CCC2C(C)C |
| InChI | InChI=1S/C12H16/c1-9(2)11-8-7-10-5-3-4-6-12(10)11/h3-6,9,11H,7-8H2,1-2H3/i5T |
| InChIKey | FLUHDWXWFRCIFJ-XHHURNKPSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |