C11H15NO2S — CID 67418342
1-(2,3-dihydro-1H-inden-1-yl)ethanesulfonamide (PubChem CID 67418342) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)ethanesulfonamide.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 67418342 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)ethanesulfonamide |
| SMILES | CC(C1CCc2ccccc21)S(N)(=O)=O |
| InChI | InChI=1S/C11H15NO2S/c1-8(15(12,13)14)10-7-6-9-4-2-3-5-11(9)10/h2-5,8,10H,6-7H2,1H3,(H2,12,13,14) |
| InChIKey | VXDBYKNUYZYKBZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |