C17H16O2S — CID 87904940
phenyl 2-(2,3-dihydro-1H-inden-1-yl)-2-sulfanylacetate (PubChem CID 87904940) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is phenyl 2-(2,3-dihydro-1H-inden-1-yl)-2-sulfanylacetate.
| Compound Name | phenyl 2-(2,3-dihydro-1H-inden-1-yl)-2-sulfanylacetate |
|---|---|
| PubChem CID | 87904940 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | phenyl 2-(2,3-dihydro-1H-inden-1-yl)-2-sulfanylacetate |
| SMILES | O=C(Oc1ccccc1)C(S)C1CCc2ccccc21 |
| InChI | InChI=1S/C17H16O2S/c18-17(19-13-7-2-1-3-8-13)16(20)15-11-10-12-6-4-5-9-14(12)15/h1-9,15-16,20H,10-11H2 |
| InChIKey | USMWSOPKRBFXHD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|