C12H16O — CID 63247593
1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol (PubChem CID 63247593) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 63247593 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol |
| SMILES | CC(O)C1CCCc2ccccc21 |
| InChI | InChI=1S/C12H16O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7,9,11,13H,4,6,8H2,1H3 |
| InChIKey | RJBQWCZPSDVJOX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |