C15H20O2 — CID 63562647
oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methanol (PubChem CID 63562647) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methanol.
| Compound Name | oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 63562647 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methanol |
| SMILES | OC(C1CCOC1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H20O2/c16-15(12-8-9-17-10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,12,14-16H,3,5,7-10H2 |
| InChIKey | DNLKEIXLKVOCJJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |