About oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol
oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol (PubChem CID 65412556) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol.
Molecular Properties
| Compound Name | oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
| PubChem CID | 65412556 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol |
| SMILES | OC(C1CCOC1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H20O2/c16-15(14-7-8-17-10-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-4,13-16H,5-10H2 |
| InChIKey | JZGALWACVDKHNS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol?
The IUPAC name of oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol (CID 65412556) is oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol.
What is the SMILES notation for oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol?
The canonical SMILES for oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol is OC(C1CCOC1)C1CCc2ccccc2C1.
What is the InChIKey of oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol?
The InChIKey is JZGALWACVDKHNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c16-15(14-7-8-17-10-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-4,13-16H,5-10H2.
What are the key properties of oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol?
oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol has a molecular weight of 232.32 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanol is sourced from PubChem (CID 65412556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).