C17H26O — CID 82920616
3-ethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pentan-1-ol (PubChem CID 82920616) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 3-ethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pentan-1-ol.
| Compound Name | 3-ethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 82920616 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 3-ethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pentan-1-ol |
| SMILES | CCC(CC)CC(O)C1CCCc2ccccc21 |
| InChI | InChI=1S/C17H26O/c1-3-13(4-2)12-17(18)16-11-7-9-14-8-5-6-10-15(14)16/h5-6,8,10,13,16-18H,3-4,7,9,11-12H2,1-2H3 |
| InChIKey | AWHBASXTCJECCO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |