C18H19ClO — CID 63247324
2-(2-chlorophenyl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol (PubChem CID 63247324) has the molecular formula C18H19ClO and a molecular weight of 286.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol.
| Compound Name | 2-(2-chlorophenyl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 63247324 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethanol |
| SMILES | OC(Cc1ccccc1Cl)C1CCCc2ccccc21 |
| InChI | InChI=1S/C18H19ClO/c19-17-11-4-2-7-14(17)12-18(20)16-10-5-8-13-6-1-3-9-15(13)16/h1-4,6-7,9,11,16,18,20H,5,8,10,12H2 |
| InChIKey | BAQRNHWUHNWBIW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |