C17H16F2O — CID 65410003
2-(2,4-difluorophenyl)-1-(2,3-dihydro-1H-inden-1-yl)ethanol (PubChem CID 65410003) has the molecular formula C17H16F2O and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(2,3-dihydro-1H-inden-1-yl)ethanol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(2,3-dihydro-1H-inden-1-yl)ethanol |
|---|---|
| PubChem CID | 65410003 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(2,3-dihydro-1H-inden-1-yl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1F)C1CCc2ccccc21 |
| InChI | InChI=1S/C17H16F2O/c18-13-7-5-12(16(19)10-13)9-17(20)15-8-6-11-3-1-2-4-14(11)15/h1-5,7,10,15,17,20H,6,8-9H2 |
| InChIKey | WIAKULJUFJTEJK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |