C15H11ClF2 — CID 66395575
7-[chloro-(2,4-difluorophenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 66395575) has the molecular formula C15H11ClF2 and a molecular weight of 264.70 g/mol. Its IUPAC name is 7-[chloro-(2,4-difluorophenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-[chloro-(2,4-difluorophenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 66395575 |
| Molecular Formula | C15H11ClF2 |
| Molecular Weight | 264.70 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 7-[chloro-(2,4-difluorophenyl)methyl]bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | Fc1ccc(C(Cl)C2Cc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C15H11ClF2/c16-15(12-6-5-10(17)8-14(12)18)13-7-9-3-1-2-4-11(9)13/h1-6,8,13,15H,7H2 |
| InChIKey | KTVFZCKAGUWGIY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|