C17H14O2S2 — CID 106600969
1-benzothiophen-7-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanol (PubChem CID 106600969) has the molecular formula C17H14O2S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-benzothiophen-7-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanol.
| Compound Name | 1-benzothiophen-7-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanol |
|---|---|
| PubChem CID | 106600969 |
| Molecular Formula | C17H14O2S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-benzothiophen-7-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanol |
| SMILES | OC(c1cccc2ccsc12)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C17H14O2S2/c18-16(12-5-3-4-11-8-9-20-17(11)12)14-10-21-15-7-2-1-6-13(15)19-14/h1-9,14,16,18H,10H2 |
| InChIKey | JYFPRRAPIMCQMD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |