C12H16O3S — CID 106601046
1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-ethoxyethanol (PubChem CID 106601046) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-ethoxyethanol.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 106601046 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-ethoxyethanol |
| SMILES | CCOCC(O)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C12H16O3S/c1-2-14-7-9(13)11-8-16-12-6-4-3-5-10(12)15-11/h3-6,9,11,13H,2,7-8H2,1H3 |
| InChIKey | UQOOYTFMPUTNDP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |