C14H14O2S2 — CID 106600901
1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-thiophen-3-ylethanol (PubChem CID 106600901) has the molecular formula C14H14O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106600901 |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxathiin-2-yl)-2-thiophen-3-ylethanol |
| SMILES | OC(Cc1ccsc1)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C14H14O2S2/c15-11(7-10-5-6-17-8-10)13-9-18-14-4-2-1-3-12(14)16-13/h1-6,8,11,13,15H,7,9H2 |
| InChIKey | DXBXQBCYQXXGGN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |