C10H14O3S — CID 65350596
1-(1,4-dioxan-2-yl)-2-thiophen-3-ylethanol (PubChem CID 65350596) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(1,4-dioxan-2-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 65350596 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-2-thiophen-3-ylethanol |
| SMILES | OC(Cc1ccsc1)C1COCCO1 |
| InChI | InChI=1S/C10H14O3S/c11-9(5-8-1-4-14-7-8)10-6-12-2-3-13-10/h1,4,7,9-11H,2-3,5-6H2 |
| InChIKey | KBSIGUYFUCZHEG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |