C9H12O2S — CID 71386496
2-(2-thiophen-3-ylethyl)-1,3-dioxolane (PubChem CID 71386496) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-(2-thiophen-3-ylethyl)-1,3-dioxolane.
| Compound Name | 2-(2-thiophen-3-ylethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 71386496 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(2-thiophen-3-ylethyl)-1,3-dioxolane |
| SMILES | c1cc(CCC2OCCO2)cs1 |
| InChI | InChI=1S/C9H12O2S/c1(8-3-6-12-7-8)2-9-10-4-5-11-9/h3,6-7,9H,1-2,4-5H2 |
| InChIKey | GHLGDRICJANSCN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |