C11H14O3S — CID 103543685
1-(1,3-dioxolan-2-yl)-4-thiophen-3-ylbutan-2-one (PubChem CID 103543685) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-4-thiophen-3-ylbutan-2-one.
| Compound Name | 1-(1,3-dioxolan-2-yl)-4-thiophen-3-ylbutan-2-one |
|---|---|
| PubChem CID | 103543685 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-4-thiophen-3-ylbutan-2-one |
| SMILES | O=C(CCc1ccsc1)CC1OCCO1 |
| InChI | InChI=1S/C11H14O3S/c12-10(7-11-13-4-5-14-11)2-1-9-3-6-15-8-9/h3,6,8,11H,1-2,4-5,7H2 |
| InChIKey | DIRVVRDUFBTNGI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |