C11H17NO2S — CID 65351038
1-(1,4-dioxan-2-yl)-3-thiophen-3-ylpropan-1-amine (PubChem CID 65351038) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(1,4-dioxan-2-yl)-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 65351038 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-3-thiophen-3-ylpropan-1-amine |
| SMILES | NC(CCc1ccsc1)C1COCCO1 |
| InChI | InChI=1S/C11H17NO2S/c12-10(11-7-13-4-5-14-11)2-1-9-3-6-15-8-9/h3,6,8,10-11H,1-2,4-5,7,12H2 |
| InChIKey | OXVVZGKDUKDQGA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |