C12H15ClO3 — CID 65350697
2-(3-chlorophenyl)-1-(1,4-dioxan-2-yl)ethanol (PubChem CID 65350697) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(1,4-dioxan-2-yl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(1,4-dioxan-2-yl)ethanol |
|---|---|
| PubChem CID | 65350697 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(1,4-dioxan-2-yl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)C1COCCO1 |
| InChI | InChI=1S/C12H15ClO3/c13-10-3-1-2-9(6-10)7-11(14)12-8-15-4-5-16-12/h1-3,6,11-12,14H,4-5,7-8H2 |
| InChIKey | AHUMZQUKZSPHNT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |