C16H23ClO — CID 65389818
2-(3-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol (PubChem CID 65389818) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65389818 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol |
| SMILES | CC1(C)CCC(C(O)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H23ClO/c1-16(2)8-6-13(7-9-16)15(18)11-12-4-3-5-14(17)10-12/h3-5,10,13,15,18H,6-9,11H2,1-2H3 |
| InChIKey | CTUCSWFYGMFXOJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |