C16H22BrFO — CID 65390212
2-(3-bromo-4-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol (PubChem CID 65390212) has the molecular formula C16H22BrFO and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65390212 |
| Molecular Formula | C16H22BrFO |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanol |
| SMILES | CC1(C)CCC(C(O)Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C16H22BrFO/c1-16(2)7-5-12(6-8-16)15(19)10-11-3-4-14(18)13(17)9-11/h3-4,9,12,15,19H,5-8,10H2,1-2H3 |
| InChIKey | YVCFFDIZVMYEAT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |