C12H14BrFO — CID 64986950
2-(3-bromo-4-fluorophenyl)-1-cyclobutylethanol (PubChem CID 64986950) has the molecular formula C12H14BrFO and a molecular weight of 273.14 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-cyclobutylethanol.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-cyclobutylethanol |
|---|---|
| PubChem CID | 64986950 |
| Molecular Formula | C12H14BrFO |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-cyclobutylethanol |
| SMILES | OC(Cc1ccc(F)c(Br)c1)C1CCC1 |
| InChI | InChI=1S/C12H14BrFO/c13-10-6-8(4-5-11(10)14)7-12(15)9-2-1-3-9/h4-6,9,12,15H,1-3,7H2 |
| InChIKey | VMYIMBXVEZQKNM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |