C15H20F2O — CID 82920862
2-(3,4-difluorophenyl)-1-(3-methylcyclohexyl)ethanol (PubChem CID 82920862) has the molecular formula C15H20F2O and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(3-methylcyclohexyl)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-1-(3-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 82920862 |
| Molecular Formula | C15H20F2O |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(3-methylcyclohexyl)ethanol |
| SMILES | CC1CCCC(C(O)Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H20F2O/c1-10-3-2-4-12(7-10)15(18)9-11-5-6-13(16)14(17)8-11/h5-6,8,10,12,15,18H,2-4,7,9H2,1H3 |
| InChIKey | PBSGAJILACVEON-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |