C15H21BrO — CID 63519836
2-(3-bromophenyl)-1-cycloheptylethanol (PubChem CID 63519836) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-cycloheptylethanol.
| Compound Name | 2-(3-bromophenyl)-1-cycloheptylethanol |
|---|---|
| PubChem CID | 63519836 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(3-bromophenyl)-1-cycloheptylethanol |
| SMILES | OC(Cc1cccc(Br)c1)C1CCCCCC1 |
| InChI | InChI=1S/C15H21BrO/c16-14-9-5-6-12(10-14)11-15(17)13-7-3-1-2-4-8-13/h5-6,9-10,13,15,17H,1-4,7-8,11H2 |
| InChIKey | DDJDWHDKTMHQJA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |