C15H21BrOS — CID 82932372
2-(3-bromophenyl)sulfanyl-1-cycloheptylethanol (PubChem CID 82932372) has the molecular formula C15H21BrOS and a molecular weight of 329.30 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-cycloheptylethanol.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-cycloheptylethanol |
|---|---|
| PubChem CID | 82932372 |
| Molecular Formula | C15H21BrOS |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-cycloheptylethanol |
| SMILES | OC(CSc1cccc(Br)c1)C1CCCCCC1 |
| InChI | InChI=1S/C15H21BrOS/c16-13-8-5-9-14(10-13)18-11-15(17)12-6-3-1-2-4-7-12/h5,8-10,12,15,17H,1-4,6-7,11H2 |
| InChIKey | AWLZITKRWBNRRD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |