C14H21BrN2S — CID 105238366
[2-(3-bromophenyl)sulfanyl-1-cyclohexylethyl]hydrazine (PubChem CID 105238366) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is [2-(3-bromophenyl)sulfanyl-1-cyclohexylethyl]hydrazine.
| Compound Name | [2-(3-bromophenyl)sulfanyl-1-cyclohexylethyl]hydrazine |
|---|---|
| PubChem CID | 105238366 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [2-(3-bromophenyl)sulfanyl-1-cyclohexylethyl]hydrazine |
| SMILES | NNC(CSc1cccc(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H21BrN2S/c15-12-7-4-8-13(9-12)18-10-14(17-16)11-5-2-1-3-6-11/h4,7-9,11,14,17H,1-3,5-6,10,16H2 |
| InChIKey | MLUHLCCXCQULKD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|