C13H18BrNS — CID 82931960
2-(3-bromophenyl)sulfanyl-2-cyclopentylethanamine (PubChem CID 82931960) has the molecular formula C13H18BrNS and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-2-cyclopentylethanamine.
| Compound Name | 2-(3-bromophenyl)sulfanyl-2-cyclopentylethanamine |
|---|---|
| PubChem CID | 82931960 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-2-cyclopentylethanamine |
| SMILES | NCC(Sc1cccc(Br)c1)C1CCCC1 |
| InChI | InChI=1S/C13H18BrNS/c14-11-6-3-7-12(8-11)16-13(9-15)10-4-1-2-5-10/h3,6-8,10,13H,1-2,4-5,9,15H2 |
| InChIKey | JNZROUSELHOOIP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |