C16H15BrClNS — CID 81160108
N-[[4-(3-bromophenyl)sulfanyl-3-chlorophenyl]methyl]cyclopropanamine (PubChem CID 81160108) has the molecular formula C16H15BrClNS and a molecular weight of 368.73 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)sulfanyl-3-chlorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(3-bromophenyl)sulfanyl-3-chlorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81160108 |
| Molecular Formula | C16H15BrClNS |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | N-[[4-(3-bromophenyl)sulfanyl-3-chlorophenyl]methyl]cyclopropanamine |
| SMILES | Clc1cc(CNC2CC2)ccc1Sc1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrClNS/c17-12-2-1-3-14(9-12)20-16-7-4-11(8-15(16)18)10-19-13-5-6-13/h1-4,7-9,13,19H,5-6,10H2 |
| InChIKey | FCEKZBYFPFICNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |